CAS 676116-80-6 is the registry number for 7-Fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
7-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one (CAS 676116-80-6) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: 7-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one. InChIKey: KRNLKGNECZGVPJ-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 7-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | KRNLKGNECZGVPJ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC2=C1C=CC(=C2)F)C |
Computed by PubChem (NCBI)