CAS 1242184-43-5 appears in our catalog under these names: Oseltamivir acid–d3, Oseltamivir acid-D3, Oseltamivir-d3 Acid, >95% (HPLC), Oseltamivir acid-d3, 99.01%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 5mg, on request, 1mg, 25mg, 10mg, 5 mg, 1 mg.
(3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylic acid (CAS 1242184-43-5) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 287.37 g/mol. IUPAC name: (3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylic acid. InChIKey: NENPYTRHICXVCS-HCNPJKKLSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 287.37 g/mol |
| IUPAC name | (3R,4R,5S)-5-amino-3-pentan-3-yloxy-4-[(2,2,2-trideuterioacetyl)amino]cyclohexene-1-carboxylic acid |
| InChIKey | NENPYTRHICXVCS-HCNPJKKLSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H]1[C@H](CC(=C[C@H]1OC(CC)CC)C(=O)O)N |
Computed by PubChem (NCBI)