Products 1242260-34-9
CAS 1242260-34-9 appears in our catalog under these names: 4-Amino-8-bromo-6-methylquinoline-3-carboxylic acid ethyl ester, 95%, Ethyl 4-amino-8-bromo-6-methylquinoline-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 4-amino-8-bromo-6-methylquinoline-3-carboxylate (CAS 1242260-34-9) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: ethyl 4-amino-8-bromo-6-methylquinoline-3-carboxylate. InChIKey: XXRCSCXQXKJDKV-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | ethyl 4-amino-8-bromo-6-methylquinoline-3-carboxylate |
| InChIKey | XXRCSCXQXKJDKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=CC(=CC2=C1N)C)Br |
Computed by PubChem (NCBI)