Products 175203-24-4

CAS 175203-24-4 is the registry number for 3-[(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 175203-24-4) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: HSTGVTRSHDNWHK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13BrN2O2
Molecular weight309.16 g/mol
IUPAC name3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid
InChIKeyHSTGVTRSHDNWHK-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CC2=CC(=CC=C2)C(=O)O)C)Br

Computed by PubChem (NCBI)