CAS 175203-24-4 is the registry number for 3-[(4-Bromo-3,5-dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg.
3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid (CAS 175203-24-4) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid. InChIKey: HSTGVTRSHDNWHK-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | 3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]benzoic acid |
| InChIKey | HSTGVTRSHDNWHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC(=CC=C2)C(=O)O)C)Br |
Computed by PubChem (NCBI)