CAS 385831-39-0 is the registry number for Ethyl 1-(4-bromophenyl)-3-methyl-1H-pyrazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Ethyl 2-(4-bromophenyl)-5-methylpyrazole-3-carboxylate (CAS 385831-39-0) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: ethyl 2-(4-bromophenyl)-5-methylpyrazole-3-carboxylate. InChIKey: HOABFDHEOPEUSD-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | ethyl 2-(4-bromophenyl)-5-methylpyrazole-3-carboxylate |
| InChIKey | HOABFDHEOPEUSD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)