CAS 851298-02-7 is the registry number for 4-(3-(4-Bromophenyl)acryloyl)piperazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(4-bromophenyl)prop-2-enoyl]piperazin-2-one (CAS 851298-02-7) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: 4-[(E)-3-(4-bromophenyl)prop-2-enoyl]piperazin-2-one. InChIKey: YKWKFDNRTUEVEA-ZZXKWVIFSA-N.
| Molecular formula | C13H13BrN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | 4-[(E)-3-(4-bromophenyl)prop-2-enoyl]piperazin-2-one |
| InChIKey | YKWKFDNRTUEVEA-ZZXKWVIFSA-N |
| SMILES | C1CN(CC(=O)N1)C(=O)/C=C/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)