CAS 1242336-79-3 is the registry number for 5-Iodo-7-azaindole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS 1242336-79-3) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid. InChIKey: HJOLCBNOZOKDFZ-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 5-iodo-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | HJOLCBNOZOKDFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(=O)O)I |
Computed by PubChem (NCBI)