Products 885520-67-2
CAS 885520-67-2 appears in our catalog under these names: 6-Iodo-1h-indazole-3-carboxylic acid, 95%, 6-Iodo-1H-indazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g.
6-iodo-1H-indazole-3-carboxylic acid (CAS 885520-67-2) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 6-iodo-1H-indazole-3-carboxylic acid. InChIKey: RRJVCGPPXNEYJQ-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 6-iodo-1H-indazole-3-carboxylic acid |
| InChIKey | RRJVCGPPXNEYJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)NN=C2C(=O)O |
Computed by PubChem (NCBI)