Products 1086391-11-8
CAS 1086391-11-8 appears in our catalog under these names: 3-Iodo-1h-indazole-6-carboxylic acid, 96%, 3–Iodo–2H–indazole–6–carboxylic acid, 3-iodo-1H-indazole-6-carboxylic acid, 3-Iodo-1H-indazole-6-carboxylic acid 96%, 3-Iodo-1H-indazole-6-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 250mg, 500mg.
3-iodo-2H-indazole-6-carboxylic acid (CAS 1086391-11-8) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-2H-indazole-6-carboxylic acid. InChIKey: PTPFULUJKFPTCV-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-2H-indazole-6-carboxylic acid |
| InChIKey | PTPFULUJKFPTCV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1C(=O)O)I |
Computed by PubChem (NCBI)