Products 885520-80-9
CAS 885520-80-9 appears in our catalog under these names: 3-Iodo-1h-indazole-4-carboxylic acid, 95%, 3-Iodo-1H-indazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
3-iodo-2H-indazole-4-carboxylic acid (CAS 885520-80-9) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-2H-indazole-4-carboxylic acid. InChIKey: POTWVYVTMBLLKR-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-2H-indazole-4-carboxylic acid |
| InChIKey | POTWVYVTMBLLKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)C(=O)O)I |
Computed by PubChem (NCBI)