Products 13858-07-6
CAS 13858-07-6 is the registry number for 3-Phenyl-4-iodosydnone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-iodo-3-phenyloxadiazol-3-ium-5-olate (CAS 13858-07-6) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 4-iodo-3-phenyloxadiazol-3-ium-5-olate. InChIKey: XMMFDMXGNNSLGS-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 4-iodo-3-phenyloxadiazol-3-ium-5-olate |
| InChIKey | XMMFDMXGNNSLGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[N+]2=NOC(=C2I)[O-] |
Computed by PubChem (NCBI)