CAS 1242567-09-4 appears in our catalog under these names: Balsalazide USP Impurity 2, (E)-3-((4-((2-Carboxyethyl)carbamoyl)phenyl)diazenyl)-2-hydroxybenzoic acid, 98%, Balsalazide Impurity 5, Balsalazide Impurity 3(Balsalazide USP RC B), Balsalazide 3-Isomer, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid (CAS 1242567-09-4) is a chemical compound with the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. IUPAC name: 3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid. InChIKey: PBNQWLIZMZLIBW-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O6 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | 3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| InChIKey | PBNQWLIZMZLIBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N=NC2=CC=C(C=C2)C(=O)NCCC(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)