CAS 1246834-21-8 appears in our catalog under these names: Balsalazide-d3 Disodium Salt, Balsalazide–d3, Balsalazide-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2,4,5-trideuterio-6-hydroxybenzoic acid (CAS 1246834-21-8) is a chemical compound with the molecular formula C17H15N3O6 and a molecular weight of 360.34 g/mol. IUPAC name: 3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2,4,5-trideuterio-6-hydroxybenzoic acid. InChIKey: IPOKCKJONYRRHP-DINNLGBQSA-N.
| Molecular formula | C17H15N3O6 |
|---|---|
| Molecular weight | 360.34 g/mol |
| IUPAC name | 3-[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2,4,5-trideuterio-6-hydroxybenzoic acid |
| InChIKey | IPOKCKJONYRRHP-DINNLGBQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N=NC2=CC=C(C=C2)C(=O)NCCC(=O)O)[2H])C(=O)O)O)[2H] |
Computed by PubChem (NCBI)