CAS 1798395-96-6 appears in our catalog under these names: Balsalazide USP RC B, ((E)-5-((M-((2-Carboxyethyl)carbamoyl)phenyl)azo)-2-salicylic acid). Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 100mg, 50mg.
5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid (CAS 1798395-96-6) is a chemical compound with the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. IUPAC name: 5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid. InChIKey: GWBSJSQWPHCLJL-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O6 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | 5-[[3-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| InChIKey | GWBSJSQWPHCLJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=NC2=CC(=C(C=C2)O)C(=O)O)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)