Products 635301-86-9
CAS 635301-86-9 appears in our catalog under these names: Rivaroxaban Impurity 110, 4-Nitrophenyl (4-(3-oxomorpholino)phenyl)carbamate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(4-nitrophenyl) N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate (CAS 635301-86-9) is a chemical compound with the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. IUPAC name: (4-nitrophenyl) N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate. InChIKey: LNDXRKGUHRAKBC-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O6 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | (4-nitrophenyl) N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate |
| InChIKey | LNDXRKGUHRAKBC-UHFFFAOYSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)