CAS 1242881-24-8 is the registry number for 3-(2,4,5-Trimethylphenyl)-1H-pyrazole-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4,5-trimethylphenyl)-1H-pyrazole-4-carbaldehyde (CAS 1242881-24-8) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 5-(2,4,5-trimethylphenyl)-1H-pyrazole-4-carbaldehyde. InChIKey: FGAXURHXKGKYMT-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 5-(2,4,5-trimethylphenyl)-1H-pyrazole-4-carbaldehyde |
| InChIKey | FGAXURHXKGKYMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)C2=C(C=NN2)C=O)C |
Computed by PubChem (NCBI)