CAS 1243145-04-1 is the registry number for Methyl alpha-Acetyl-2,4-dichlorobenzeneacetate. Offered by: TRC. Available pack sizes: 500mg.
Methyl 2-(2,4-dichlorophenyl)-3-oxobutanoate (CAS 1243145-04-1) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: methyl 2-(2,4-dichlorophenyl)-3-oxobutanoate. InChIKey: WHSRFPPONLMREV-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O3 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | methyl 2-(2,4-dichlorophenyl)-3-oxobutanoate |
| InChIKey | WHSRFPPONLMREV-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=C(C=C(C=C1)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)