Products 2279122-16-4

CAS 2279122-16-4 is the registry number for 3,5-Dichloro-4-cyclopropylmethoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-(cyclopropylmethoxy)benzoic acid (CAS 2279122-16-4) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: 3,5-dichloro-4-(cyclopropylmethoxy)benzoic acid. InChIKey: NOUYHXGJECDIQF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10Cl2O3
Molecular weight261.10 g/mol
IUPAC name3,5-dichloro-4-(cyclopropylmethoxy)benzoic acid
InChIKeyNOUYHXGJECDIQF-UHFFFAOYSA-N
SMILESC1CC1COC2=C(C=C(C=C2Cl)C(=O)O)Cl

Computed by PubChem (NCBI)