CAS 168135-66-8 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)-5-oxovaleric acid, 95%, 5-(3,4-Dichlorophenyl)-5-oxovaleric acid, 95+%, 5-(3,4-Dichlorophenyl)-5-oxopentanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-(3,4-dichlorophenyl)-5-oxopentanoic acid (CAS 168135-66-8) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-5-oxopentanoic acid. InChIKey: XDNXUPLVNCSNBM-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O3 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-5-oxopentanoic acid |
| InChIKey | XDNXUPLVNCSNBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CCCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)