CAS 2110702-60-6 is the registry number for Methyl 7,8-dichlorochromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2110702-60-6) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: methyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: ZQBXKQIDXHRTNV-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O3 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | methyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | ZQBXKQIDXHRTNV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C(=C(C=C2)Cl)Cl)OC1 |
Computed by PubChem (NCBI)