Products 124335-65-5

CAS 124335-65-5 is the registry number for 2-(4-(2-Hydroxyethyl)piperazin-1-yl)acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[4-(2-hydroxyethyl)piperazin-1-yl]acetic acid (CAS 124335-65-5) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: 2-[4-(2-hydroxyethyl)piperazin-1-yl]acetic acid. InChIKey: VCEKKKPFXABURR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O3
Molecular weight188.22 g/mol
IUPAC name2-[4-(2-hydroxyethyl)piperazin-1-yl]acetic acid
InChIKeyVCEKKKPFXABURR-UHFFFAOYSA-N
SMILESC1CN(CCN1CCO)CC(=O)O

Computed by PubChem (NCBI)