CAS 124340-77-8 is the registry number for 2-(Thiophen-2-yl)-1H-1,3-benzodiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid (CAS 124340-77-8) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid. InChIKey: OQFMKFSAZCQYAK-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid |
| InChIKey | OQFMKFSAZCQYAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=N2)C3=CC=CS3)C(=O)O |
Computed by PubChem (NCBI)