Products 124340-77-8

CAS 124340-77-8 is the registry number for 2-(Thiophen-2-yl)-1H-1,3-benzodiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid (CAS 124340-77-8) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid. InChIKey: OQFMKFSAZCQYAK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8N2O2S
Molecular weight244.27 g/mol
IUPAC name2-thiophen-2-yl-1H-benzimidazole-4-carboxylic acid
InChIKeyOQFMKFSAZCQYAK-UHFFFAOYSA-N
SMILESC1=CC(=C2C(=C1)NC(=N2)C3=CC=CS3)C(=O)O

Computed by PubChem (NCBI)