CAS 61636-28-0 appears in our catalog under these names: 3-(2-Amino-1,3-thiazol-4-yl)-2h-chromen-2-one hydrobromide, 95%, 3-(2-Aminothiazol-4-yl)-2H-chromen-2-one, 95+%, 3-(2-Amino-thiazol-4-yl)-chromen-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g.
3-(2-amino-1,3-thiazol-4-yl)chromen-2-one (CAS 61636-28-0) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 3-(2-amino-1,3-thiazol-4-yl)chromen-2-one. InChIKey: ABPCYGDHBSSVKC-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 3-(2-amino-1,3-thiazol-4-yl)chromen-2-one |
| InChIKey | ABPCYGDHBSSVKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)