CAS 251457-88-2 is the registry number for 2-(1H-Pyrrol-1-yl)-1,3-benzothiazole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid (CAS 251457-88-2) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid. InChIKey: DPZMSPMBTFFIAN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-pyrrol-1-yl-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | DPZMSPMBTFFIAN-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=NC3=C(S2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)