CAS 87874-18-8 is the registry number for N-(Benzo[d]thiazol-2-yl)furan-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzothiazol-2-yl)furan-2-carboxamide (CAS 87874-18-8) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)furan-2-carboxamide. InChIKey: IEHMTXRMAOBNOS-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)furan-2-carboxamide |
| InChIKey | IEHMTXRMAOBNOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)