CAS 1243472-58-3 is the registry number for 4-Hydroxy-n,n,2-trimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-hydroxy-N,N,2-trimethylbenzamide (CAS 1243472-58-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-hydroxy-N,N,2-trimethylbenzamide. InChIKey: PSRKVLMYGKAQQO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-hydroxy-N,N,2-trimethylbenzamide |
| InChIKey | PSRKVLMYGKAQQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O)C(=O)N(C)C |
Computed by PubChem (NCBI)