Products 1243695-73-9
CAS 1243695-73-9 is the registry number for (1-(Sec-butyl)-5-chloro-1H-benzo(D)imidazol-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 10g, 25g.
(1-butan-2-yl-5-chlorobenzimidazol-2-yl)methanol (CAS 1243695-73-9) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: (1-butan-2-yl-5-chlorobenzimidazol-2-yl)methanol. InChIKey: MSOBEGNXFSPWDK-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (1-butan-2-yl-5-chlorobenzimidazol-2-yl)methanol |
| InChIKey | MSOBEGNXFSPWDK-UHFFFAOYSA-N |
| SMILES | CCC(C)N1C2=C(C=C(C=C2)Cl)N=C1CO |
Computed by PubChem (NCBI)