Products 124383-92-2
CAS 124383-92-2 is the registry number for L-Isoleucyl diphenylborinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Diphenylboranyl (2S,3S)-2-amino-3-methylpentanoate (CAS 124383-92-2) is a chemical compound with the molecular formula C18H22BNO2 and a molecular weight of 295.2 g/mol. IUPAC name: diphenylboranyl (2S,3S)-2-amino-3-methylpentanoate. InChIKey: VNPIANARMZOPIS-YOEHRIQHSA-N.
| Molecular formula | C18H22BNO2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | diphenylboranyl (2S,3S)-2-amino-3-methylpentanoate |
| InChIKey | VNPIANARMZOPIS-YOEHRIQHSA-N |
| SMILES | B(C1=CC=CC=C1)(C2=CC=CC=C2)OC(=O)[C@H]([C@@H](C)CC)N |
Computed by PubChem (NCBI)
Synonyms:
L-Isoleucyl diphenylborinate