CAS 2223028-74-6 is the registry number for 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(p-tolyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223028-74-6) is a chemical compound with the molecular formula C18H22BNO2 and a molecular weight of 295.2 g/mol. IUPAC name: 2-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OACNMUNOZLGJQR-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 2-(4-methylphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OACNMUNOZLGJQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)