CAS 1801421-24-8 appears in our catalog under these names: N-Phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%, N-Phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g.
N-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1801421-24-8) is a chemical compound with the molecular formula C18H22BNO2 and a molecular weight of 295.2 g/mol. IUPAC name: N-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: SXKKDEXCRQUQIP-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | N-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | SXKKDEXCRQUQIP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NC3=CC=CC=C3 |
Computed by PubChem (NCBI)