CAS 2094504-02-4 is the registry number for 2-Benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2094504-02-4) is a chemical compound with the molecular formula C18H22BNO2 and a molecular weight of 295.2 g/mol. IUPAC name: 2-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RGUQYAAWRLVFQC-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 2-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RGUQYAAWRLVFQC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)