CAS 124421-12-1 appears in our catalog under these names: 1-chloro-2-isocyanato-3,5-dimethylbenzene, ≥95%, Benzene, 1-chloro-2-isocyanato-3,5-dimethyl-, ≥95%, 2-Chloro-4,6-dimethylphenyl isocyanate, 95%. Offered by: Chemat, Fluorochem, Combi-blocks. Available pack sizes: 1g.
1-chloro-2-isocyanato-3,5-dimethylbenzene (CAS 124421-12-1) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 1-chloro-2-isocyanato-3,5-dimethylbenzene. InChIKey: GRPKAFNBYGDGCX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 1-chloro-2-isocyanato-3,5-dimethylbenzene |
| InChIKey | GRPKAFNBYGDGCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)N=C=O)C |
Computed by PubChem (NCBI)