CAS 124500-60-3 is the registry number for 4-(4-Nitrophenyl)cyclohexanone. Offered by: TRC. Available pack sizes: 100mg.
4-(4-nitrophenyl)cyclohexan-1-one (CAS 124500-60-3) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(4-nitrophenyl)cyclohexan-1-one. InChIKey: QOKGZTDRQTUUSB-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-(4-nitrophenyl)cyclohexan-1-one |
| InChIKey | QOKGZTDRQTUUSB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)