CAS 1245465-10-4 is the registry number for 6-bromo-1-methyl-1H-indazole-4-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g.
6-bromo-1-methylindazole-4-carbonitrile (CAS 1245465-10-4) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 6-bromo-1-methylindazole-4-carbonitrile. InChIKey: IUNHKGUIWGVTJY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 6-bromo-1-methylindazole-4-carbonitrile |
| InChIKey | IUNHKGUIWGVTJY-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=CC(=C2C=N1)C#N)Br |
Computed by PubChem (NCBI)