CAS 1245770-20-0 is the registry number for 2-(4-Bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxamide (CAS 1245770-20-0) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxamide. InChIKey: WXTXMVCDWTYVCR-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5,8-dioxaspiro[3.4]octane-2-carboxamide |
| InChIKey | WXTXMVCDWTYVCR-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)CC(C2)(C3=CC=C(C=C3)Br)C(=O)N |
Computed by PubChem (NCBI)