CAS 2140265-41-2 is the registry number for (2S)-1-[(4-Bromophenyl)carbonyl]-2-methylpyrrolidine-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-1-(4-bromobenzoyl)-2-methylpyrrolidine-2-carboxylic acid (CAS 2140265-41-2) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: (2S)-1-(4-bromobenzoyl)-2-methylpyrrolidine-2-carboxylic acid. InChIKey: VWDMHIAPLAAIMI-ZDUSSCGKSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | (2S)-1-(4-bromobenzoyl)-2-methylpyrrolidine-2-carboxylic acid |
| InChIKey | VWDMHIAPLAAIMI-ZDUSSCGKSA-N |
| SMILES | C[C@]1(CCCN1C(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)