CAS 765315-30-8 appears in our catalog under these names: tert-Butyl 5-bromo-2-oxoindoline-1-carboxylate, 95%, tert–butyl 5–bromo–2–oxoindoline–1–carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 5-bromo-2-oxo-3H-indole-1-carboxylate (CAS 765315-30-8) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: tert-butyl 5-bromo-2-oxo-3H-indole-1-carboxylate. InChIKey: QWSVFSGHDRVXOE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-oxo-3H-indole-1-carboxylate |
| InChIKey | QWSVFSGHDRVXOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)