Products 1423699-80-2
CAS 1423699-80-2 appears in our catalog under these names: Methyl 2–(4–bromobenzoyl)–3–(methylamino)but–2–enoate, Methyl 2-(4-bromobenzoyl)-3-(methylamino)but-2-enoate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-[(4-bromophenyl)-hydroxymethylidene]-3-methyliminobutanoate (CAS 1423699-80-2) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: methyl 2-[(4-bromophenyl)-hydroxymethylidene]-3-methyliminobutanoate. InChIKey: DDVAMDPZPJXCEF-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | methyl 2-[(4-bromophenyl)-hydroxymethylidene]-3-methyliminobutanoate |
| InChIKey | DDVAMDPZPJXCEF-UHFFFAOYSA-N |
| SMILES | CC(=NC)C(=C(C1=CC=C(C=C1)Br)O)C(=O)OC |
Computed by PubChem (NCBI)