CAS 1245772-68-2 appears in our catalog under these names: 4-Bromo-1-ethyl-3-(trifluoromethyl)pyrazole, 95%, 4-Bromo-1-ethyl-3-(trifluoromethyl)pyrazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g.
4-bromo-1-ethyl-3-(trifluoromethyl)pyrazole (CAS 1245772-68-2) is a chemical compound with the molecular formula C6H6BrF3N2 and a molecular weight of 243.02 g/mol. IUPAC name: 4-bromo-1-ethyl-3-(trifluoromethyl)pyrazole. InChIKey: DPIASTGKYPRSIE-UHFFFAOYSA-N.
| Molecular formula | C6H6BrF3N2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 4-bromo-1-ethyl-3-(trifluoromethyl)pyrazole |
| InChIKey | DPIASTGKYPRSIE-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)