CAS 721402-02-4 is the registry number for 4-bromo-1,5-dimethyl-3-(trifluoromethyl)pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-bromo-1,5-dimethyl-3-(trifluoromethyl)pyrazole (CAS 721402-02-4) is a chemical compound with the molecular formula C6H6BrF3N2 and a molecular weight of 243.02 g/mol. IUPAC name: 4-bromo-1,5-dimethyl-3-(trifluoromethyl)pyrazole. InChIKey: IFCNTZRBBLIUMD-UHFFFAOYSA-N.
| Molecular formula | C6H6BrF3N2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 4-bromo-1,5-dimethyl-3-(trifluoromethyl)pyrazole |
| InChIKey | IFCNTZRBBLIUMD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C(F)(F)F)Br |
Computed by PubChem (NCBI)