CAS 1417982-47-8 is the registry number for 4-Bromo-5-ethyl-3-(trifluoromethyl)-1H-Pyrazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-5-ethyl-3-(trifluoromethyl)-1H-pyrazole (CAS 1417982-47-8) is a chemical compound with the molecular formula C6H6BrF3N2 and a molecular weight of 243.02 g/mol. IUPAC name: 4-bromo-5-ethyl-3-(trifluoromethyl)-1H-pyrazole. InChIKey: ABNJLIKODABCNP-UHFFFAOYSA-N.
| Molecular formula | C6H6BrF3N2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 4-bromo-5-ethyl-3-(trifluoromethyl)-1H-pyrazole |
| InChIKey | ABNJLIKODABCNP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NN1)C(F)(F)F)Br |
Computed by PubChem (NCBI)