CAS 643759-53-9 is the registry number for 5-Bromo-1-ethyl-3-(trifluoromethyl)-1H-pyrazole, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-1-ethyl-3-(trifluoromethyl)pyrazole (CAS 643759-53-9) is a chemical compound with the molecular formula C6H6BrF3N2 and a molecular weight of 243.02 g/mol. IUPAC name: 5-bromo-1-ethyl-3-(trifluoromethyl)pyrazole. InChIKey: MEAAGPIWMGFWGJ-UHFFFAOYSA-N.
| Molecular formula | C6H6BrF3N2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 5-bromo-1-ethyl-3-(trifluoromethyl)pyrazole |
| InChIKey | MEAAGPIWMGFWGJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)