CAS 1245806-67-0 is the registry number for 5-((4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 1245806-67-0) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 5-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: LBRLANARHJMRKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 5-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | LBRLANARHJMRKQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(O2)C(=O)O)C)N |
Computed by PubChem (NCBI)