Products 1245915-41-6
CAS 1245915-41-6 is the registry number for 1-(6-Chloro-5-(trifluoromethyl)pyridin-3-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]ethanone (CAS 1245915-41-6) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]ethanone. InChIKey: XBLKIKPWBCEGEA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]ethanone |
| InChIKey | XBLKIKPWBCEGEA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(N=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)