Products 124598-11-4
CAS 124598-11-4 is the registry number for 2-Methyl-4-(2-methylbutyryl)phloroglucinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)butan-1-one (CAS 124598-11-4) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)butan-1-one. InChIKey: XGJQNJPFHJCFDN-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)butan-1-one |
| InChIKey | XGJQNJPFHJCFDN-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)C1=C(C=C(C(=C1O)C)O)O |
Computed by PubChem (NCBI)