CAS 1246090-88-9 is the registry number for 2-((1S,3R,4R)-2-Azabicyclo[2.2.1]heptan-3-yl)-4-phenylthiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]-4-phenyl-1,3-thiazole (CAS 1246090-88-9) is a chemical compound with the molecular formula C15H16N2S and a molecular weight of 256.4 g/mol. IUPAC name: 2-[(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]-4-phenyl-1,3-thiazole. InChIKey: IXSOVXPFKZUATO-MBNYWOFBSA-N.
| Molecular formula | C15H16N2S |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 2-[(1S,3R,4R)-2-azabicyclo[2.2.1]heptan-3-yl]-4-phenyl-1,3-thiazole |
| InChIKey | IXSOVXPFKZUATO-MBNYWOFBSA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H](N2)C3=NC(=CS3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)