CAS 621-01-2 appears in our catalog under these names: N,N'-Di (p-tolyl)-2-thiourea, 98%, 4,4'-Dimethylthiocarbanilide, 98%, 1,3-Di-p-tolylthiourea, 98%, 1,3–Di(p–tolyl)thiourea, 1,3-Di(p-tolyl)thiourea, >98.0%(HPLC). Offered by: Fluorochem, Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
1,3-bis(4-methylphenyl)thiourea (CAS 621-01-2) is a chemical compound with the molecular formula C15H16N2S and a molecular weight of 256.4 g/mol. IUPAC name: 1,3-bis(4-methylphenyl)thiourea. InChIKey: ULNVBRUIKLYGDF-UHFFFAOYSA-N.
| Molecular formula | C15H16N2S |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 1,3-bis(4-methylphenyl)thiourea |
| InChIKey | ULNVBRUIKLYGDF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=S)NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)