CAS 620-51-9 appears in our catalog under these names: 1,3-Bis(3-methylphenyl)thiourea, 95%, Bis((3-methylphenyl)amino)methane-1-thione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
1,3-bis(3-methylphenyl)thiourea (CAS 620-51-9) is a chemical compound with the molecular formula C15H16N2S and a molecular weight of 256.4 g/mol. IUPAC name: 1,3-bis(3-methylphenyl)thiourea. InChIKey: ZFMWVFOQAAUFDD-UHFFFAOYSA-N.
| Molecular formula | C15H16N2S |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 1,3-bis(3-methylphenyl)thiourea |
| InChIKey | ZFMWVFOQAAUFDD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=S)NC2=CC=CC(=C2)C |
Computed by PubChem (NCBI)