CAS 40398-34-3 appears in our catalog under these names: 1,1-Dibenzyl-thiourea, 95%, 1,1-Dibenzylthiourea, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1,1-dibenzylthiourea (CAS 40398-34-3) is a chemical compound with the molecular formula C15H16N2S and a molecular weight of 256.4 g/mol. IUPAC name: 1,1-dibenzylthiourea. InChIKey: AZFCIWCWYTUZRC-UHFFFAOYSA-N.
| Molecular formula | C15H16N2S |
|---|---|
| Molecular weight | 256.4 g/mol |
| IUPAC name | 1,1-dibenzylthiourea |
| InChIKey | AZFCIWCWYTUZRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)N |
Computed by PubChem (NCBI)