Products 1246254-90-9
CAS 1246254-90-9 is the registry number for 5'-C-Methylcytidine. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg.
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one (CAS 1246254-90-9) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: KPPPLADORXGUFI-KCRXGDJASA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | KPPPLADORXGUFI-KCRXGDJASA-N |
| SMILES | CC([C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)N)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
5'-C-Methylcytidine, 5'-methylcytidine